DB01694 D-tartaric acid
InChI Key: FEWJPZIEWOKRBE-LWMBPPNESA-N
SMILES: O[C@@H]([C@H](O)C(O)=O)C(O)=O
Small molecule PDB accession : TAR
List of proteins that are targets for DB01694
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P21283_DB01694 | P21283 | n/a | V-type proton ATPase subunit C 1 | |
| 2 | P26196_DB01694 | P26196 | n/a | Probable ATP-dependent RNA helicase DDX6 | |
| 3 | Q9P2W7_DB01694 | Q9P2W7 | n/a | Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1 | |
| 4 | Q9NP99_DB01694 | Q9NP99 | n/a | Triggering receptor expressed on myeloid cells 1 | |
| 5 | Q9NWT6_DB01694 | Q9NWT6 | n/a | Hypoxia-inducible factor 1-alpha inhibitor |