DB01744 Camphor
InChI Key: DSSYKIVIOFKYAU-XCBNKYQSSA-N
SMILES: [H][C@@]12CC[C@@](C)(C(=O)C1)C2(C)C
Small molecule PDB accession : CAM
List of proteins that are targets for DB01744
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | Q8NER1_DB01744 | Q8NER1 | agonist | Transient receptor potential cation channel subfamily V member 1 | |
| 2 | Q8NET8_DB01744 | Q8NET8 | agonist | Transient receptor potential cation channel subfamily V member 3 | |
| 3 | O75762_DB01744 | O75762 | inhibitor | Transient receptor potential cation channel subfamily A member 1 | |
| 4 | Q7Z2W7_DB01744 | Q7Z2W7 | activator | Transient receptor potential cation channel subfamily M member 8 |