DB01861 Uridine diphosphate glucose
InChI Key: HSCJRCZFDFQWRP-JZMIEXBBSA-N
SMILES: OC[C@H]1O[C@H](OP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=CC(=O)NC2=O)[C@H](O)[C@@H](O)[C@@H]1O
Small molecule PDB accession : UPG
List of proteins that are targets for DB01861
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | Q13304_DB01861 | Q13304 | regulator | Uracil nucleotide/cysteinyl leukotriene receptor | |
| 2 | P46976_DB01861 | P46976 | n/a | Glycogenin-1 | |
| 3 | Q14376_DB01861 | Q14376 | n/a | UDP-glucose 4-epimerase | |
| 4 | Q7Z4J2_DB01861 | Q7Z4J2 | n/a | Putative glycosyltransferase 6 domain-containing protein 1 |