DB01972 Guanosine-5'-Monophosphate
InChI Key: RQFCJASXJCIDSX-UUOKFMHZSA-N
SMILES: NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]2O)C(=O)N1
Small molecule PDB accession : G
List of proteins that are targets for DB01972
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | Q16774_DB01972 | Q16774 | n/a | Guanylate kinase | |
| 2 | P36959_DB01972 | P36959 | n/a | GMP reductase 1 | |
| 3 | O76074_DB01972 | O76074 | n/a | cGMP-specific 3',5'-cyclic phosphodiesterase | |
| 4 | P31939_DB01972 | P31939 | n/a | Bifunctional purine biosynthesis protein ATIC | |
| 5 | Q08188_DB01972 | Q08188 | n/a | Protein-glutamine gamma-glutamyltransferase E | |
| 6 | P78352_DB01972 | P78352 | n/a | Disks large homolog 4 | |
| 7 | P49773_DB01972 | P49773 | n/a | Histidine triad nucleotide-binding protein 1 |