DB02052 Indirubin-3'-monoxime
InChI Key: HBDSHCUSXQATPO-BGBJRWHRSA-N
SMILES: O\N=C1\C(\NC2=C\1C=CC=C2)=C1\C(=O)NC2=C1C=CC=C2
Small molecule PDB accession : IXM
List of proteins that are targets for DB02052
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P35869_DB02052 | P35869 | agonist | Aryl hydrocarbon receptor | |
| 2 | P06493_DB02052 | P06493 | binder | Cyclin-dependent kinase 1 | |
| 3 | Q15078_DB02052 | Q15078 | n/a | Cyclin-dependent kinase 5 activator 1 | IC50(nM) = 100.0 |
| 4 | Q00535_DB02052 | Q00535 | inhibitor | Cyclin-dependent-like kinase 5 | |
| 5 | P49841_DB02052 | P49841 | n/a | Glycogen synthase kinase-3 beta | IC50(nM) = 22.0 |
| 6 | P24941_DB02052 | P24941 | inhibitor | Cyclin-dependent kinase 2 | IC50(nM) = 440.0 |