DB02482 Phosphonothreonine
InChI Key: USRGIUJOYOXOQJ-STHAYSLISA-N
SMILES: C[C@H](OP(O)(O)=O)[C@@H](N)C(O)=O
Small molecule PDB accession : D11
List of proteins that are targets for DB02482
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P08100_DB02482 | P08100 | n/a | Rhodopsin | |
| 2 | P17612_DB02482 | P17612 | n/a | cAMP-dependent protein kinase catalytic subunit alpha | |
| 3 | Q04759_DB02482 | Q04759 | n/a | Protein kinase C theta type | |
| 4 | P31949_DB02482 | P31949 | n/a | Protein S100-A11 | |
| 5 | P50613_DB02482 | P50613 | n/a | Cyclin-dependent kinase 7 | |
| 6 | P28482_DB02482 | P28482 | n/a | Mitogen-activated protein kinase 1 | |
| 7 | O14965_DB02482 | O14965 | n/a | Aurora kinase A | |
| 8 | P53778_DB02482 | P53778 | n/a | Mitogen-activated protein kinase 12 | |
| 9 | P22694_DB02482 | P22694 | n/a | cAMP-dependent protein kinase catalytic subunit beta |