DB02659 Cholic Acid
InChI Key: BHQCQFFYRZLCQQ-OELDTZBJSA-N
SMILES: [H][C@@](C)(CCC(O)=O)[C@@]1([H])CC[C@@]2([H])[C@]3([H])[C@]([H])(O)C[C@]4([H])C[C@]([H])(O)CC[C@]4(C)[C@@]3([H])C[C@]([H])(O)[C@]12C
Small molecule PDB accession : CHD
List of proteins that are targets for DB02659
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | Q8TDU6_DB02659 | Q8TDU6 | n/a | G-protein coupled bile acid receptor 1 | IC50(nM) = 6000.0 EC50(nM) = 13600.0 |
| 2 | P10176_DB02659 | P10176 | n/a | Cytochrome c oxidase subunit 8A, mitochondrial | |
| 3 | P00395_DB02659 | P00395 | n/a | Cytochrome c oxidase subunit 1 | |
| 4 | P00414_DB02659 | P00414 | n/a | Cytochrome c oxidase subunit 3 | |
| 5 | P09669_DB02659 | P09669 | n/a | Cytochrome c oxidase subunit 6C | |
| 6 | P10606_DB02659 | P10606 | n/a | Cytochrome c oxidase subunit 5B, mitochondrial | |
| 7 | P13073_DB02659 | P13073 | n/a | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial | |
| 8 | P14854_DB02659 | P14854 | n/a | Cytochrome c oxidase subunit 6B1 | |
| 9 | P15954_DB02659 | P15954 | n/a | Cytochrome c oxidase subunit 7C, mitochondrial | |
| 10 | P20674_DB02659 | P20674 | n/a | Cytochrome c oxidase subunit 5A, mitochondrial | |
| 11 | P24311_DB02659 | P24311 | n/a | Cytochrome c oxidase subunit 7B, mitochondrial | |
| 12 | P00403_DB02659 | P00403 | n/a | Cytochrome c oxidase subunit 2 | |
| 13 | P04054_DB02659 | P04054 | n/a | Phospholipase A2 | Kd(nM) = 150000.0 |
| 14 | Q96RI1_DB02659 | Q96RI1 | n/a | Bile acid receptor | EC50(nM) = 45000.0 |
| 15 | P51161_DB02659 | P51161 | n/a | Gastrotropin | |
| 16 | P23141_DB02659 | P23141 | n/a | Liver carboxylesterase 1 | |
| 17 | P62508_DB02659 | P62508 | n/a | Estrogen-related receptor gamma | |
| 18 | P00326_DB02659 | P00326 | n/a | Alcohol dehydrogenase 1C | |
| 19 | P22830_DB02659 | P22830 | n/a | Ferrochelatase, mitochondrial | |
| 20 | P24310_DB02659 | P24310 | n/a | Cytochrome c oxidase subunit 7A1, mitochondrial | |
| 21 | Q02221_DB02659 | Q02221 | n/a | Cytochrome c oxidase subunit 6A2, mitochondrial |