DB03435 Uridine-5'-Diphosphate
InChI Key: XCCTYIAWTASOJW-XVFCMESISA-N
SMILES: O[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP(O)(=O)OP(O)(O)=O)N1C=CC(=O)NC1=O
Small molecule PDB accession : UDP
List of proteins that are targets for DB03435
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | Q13304_DB03435 | Q13304 | regulator | Uracil nucleotide/cysteinyl leukotriene receptor | |
2 | P46976_DB03435 | P46976 | n/a | Glycogenin-1 | |
3 | Q9P2W7_DB03435 | Q9P2W7 | n/a | Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1 | |
4 | P30085_DB03435 | P30085 | n/a | UMP-CMP kinase | |
5 | P16442_DB03435 | P16442 | n/a | Histo-blood group ABO system transferase | |
6 | O94766_DB03435 | O94766 | n/a | Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 3 | |
7 | Q9UBQ6_DB03435 | Q9UBQ6 | n/a | Exostosin-like 2 | |
8 | Q7Z4J2_DB03435 | Q7Z4J2 | n/a | Putative glycosyltransferase 6 domain-containing protein 1 |