DB03661 L-cysteic acid
InChI Key: XVOYSCVBGLVSOL-REOHCLBHSA-N
SMILES: N[C@@H](CS(O)(=O)=O)C(O)=O
Small molecule PDB accession : OCS
List of proteins that are targets for DB03661
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | Q9H4G4_DB03661 | Q9H4G4 | n/a | Golgi-associated plant pathogenesis-related protein 1 | |
| 2 | P30305_DB03661 | P30305 | n/a | M-phase inducer phosphatase 2 | |
| 3 | P07711_DB03661 | P07711 | n/a | Procathepsin L | |
| 4 | P18031_DB03661 | P18031 | n/a | Tyrosine-protein phosphatase non-receptor type 1 |