DB03865 6-Chloro-2-(2-Hydroxy-Biphenyl-3-Yl)-1h-Indole-5-Carboxamidine
InChI Key: FEKRWNWZMOSVBX-UHFFFAOYSA-O
SMILES: NC(=[NH2+])C1=CC2=C(NC(=C2)C2=CC=CC(=C2O)C2=CC=CC=C2)C=C1Cl
Small molecule PDB accession : 132
List of proteins that are targets for DB03865
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P05981_DB03865 | P05981 | n/a | Serine protease hepsin | Ki(nM) = 1800.0 |
| 2 | P07477_DB03865 | P07477 | n/a | Trypsin-1 | Ki(nM) = 770.0 |
| 3 | P00749_DB03865 | P00749 | n/a | Urokinase-type plasminogen activator | Ki(nM) = 9.0 |
| 4 | P00734_DB03865 | P00734 | n/a | Prothrombin | Ki(nM) = 60000.0 |