DB04395 Phosphoaminophosphonic Acid-Adenylate Ester
InChI Key: PVKSNHVPLWYQGJ-FCIPNVEPSA-N
SMILES: NC1=NC=NC2=C1N=CN2[C@@H]1O[C@@H](CO[P@](O)(=O)O[P@@](O)(=O)NP(O)(O)=O)[C@H](O)[C@H]1O
Small molecule PDB accession : A0P
List of proteins that are targets for DB04395
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P68133_DB04395 | P68133 | n/a | Actin, alpha skeletal muscle | |
2 | P49368_DB04395 | P49368 | n/a | T-complex protein 1 subunit gamma | |
3 | Q12756_DB04395 | Q12756 | n/a | Kinesin-like protein KIF1A | |
4 | Q02880_DB04395 | Q02880 | n/a | DNA topoisomerase 2-beta | |
5 | P55072_DB04395 | P55072 | n/a | Transitional endoplasmic reticulum ATPase | |
6 | P78362_DB04395 | P78362 | n/a | SRSF protein kinase 2 | |
7 | P48637_DB04395 | P48637 | n/a | Glutathione synthetase | |
8 | Q99661_DB04395 | Q99661 | n/a | Kinesin-like protein KIF2C | |
9 | P11309_DB04395 | P11309 | n/a | Serine/threonine-protein kinase pim-1 | |
10 | P13569_DB04395 | P13569 | n/a | Cystic fibrosis transmembrane conductance regulator | |
11 | P51570_DB04395 | P51570 | n/a | Galactokinase | |
12 | P23677_DB04395 | P23677 | n/a | Inositol-trisphosphate 3-kinase A | |
13 | P29317_DB04395 | P29317 | n/a | Ephrin type-A receptor 2 | |
14 | P68400_DB04395 | P68400 | n/a | Casein kinase II subunit alpha | |
15 | P53779_DB04395 | P53779 | n/a | Mitogen-activated protein kinase 10 | |
16 | P08069_DB04395 | P08069 | n/a | Insulin-like growth factor 1 receptor | |
17 | P53355_DB04395 | P53355 | n/a | Death-associated protein kinase 1 | |
18 | P49841_DB04395 | P49841 | n/a | Glycogen synthase kinase-3 beta | |
19 | P23919_DB04395 | P23919 | n/a | Thymidylate kinase | |
20 | P19367_DB04395 | P19367 | n/a | Hexokinase-1 | |
21 | P53778_DB04395 | P53778 | n/a | Mitogen-activated protein kinase 12 | |
22 | P06239_DB04395 | P06239 | n/a | Tyrosine-protein kinase Lck | |
23 | P29323_DB04395 | P29323 | n/a | Ephrin type-B receptor 2 | |
24 | Q06609_DB04395 | Q06609 | n/a | DNA repair protein RAD51 homolog 1 | |
25 | Q16877_DB04395 | Q16877 | n/a | 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 4 | |
26 | Q96QT4_DB04395 | Q96QT4 | n/a | Transient receptor potential cation channel subfamily M member 7 |