DB04522 Dexfosfoserine
InChI Key: BZQFBWGGLXLEPQ-REOHCLBHSA-N
SMILES: N[C@@H](COP(O)(O)=O)C(O)=O
Small molecule PDB accession : SEP
List of proteins that are targets for DB04522
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P08100_DB04522 | P08100 | n/a | Rhodopsin | |
2 | P29508_DB04522 | P29508 | n/a | Serpin B3 | |
3 | P17612_DB04522 | P17612 | n/a | cAMP-dependent protein kinase catalytic subunit alpha | |
4 | P11217_DB04522 | P11217 | n/a | Glycogen phosphorylase, muscle form | |
5 | P11309_DB04522 | P11309 | n/a | Serine/threonine-protein kinase pim-1 | |
6 | P13569_DB04522 | P13569 | n/a | Cystic fibrosis transmembrane conductance regulator | |
7 | Q04759_DB04522 | Q04759 | n/a | Protein kinase C theta type | |
8 | P05451_DB04522 | P05451 | n/a | Lithostathine-1-alpha | |
9 | O15530_DB04522 | O15530 | n/a | 3-phosphoinositide-dependent protein kinase 1 | |
10 | Q15796_DB04522 | Q15796 | n/a | Mothers against decapentaplegic homolog 2 | |
11 | Q03721_DB04522 | Q03721 | n/a | Potassium voltage-gated channel subfamily C member 4 | |
12 | Q9UL54_DB04522 | Q9UL54 | n/a | Serine/threonine-protein kinase TAO2 |