DB04855 Dronedarone
InChI Key: ZQTNQVWKHCQYLQ-UHFFFAOYSA-N
SMILES: CCCCN(CCCC)CCCOC1=CC=C(C=C1)C(=O)C1=C(CCCC)OC2=C1C=C(NS(C)(=O)=O)C=C2
Small molecule PDB accession : n/a
List of proteins that are targets for DB04855
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | Q02641_DB04855 | Q02641 | inhibitor | Voltage-dependent L-type calcium channel subunit beta-1 | |
2 | P54284_DB04855 | P54284 | inhibitor | Voltage-dependent L-type calcium channel subunit beta-3 | |
3 | P18825_DB04855 | P18825 | antagonist | Alpha-2C adrenergic receptor | |
4 | P18089_DB04855 | P18089 | antagonist | Alpha-2B adrenergic receptor | |
5 | O95069_DB04855 | O95069 | inhibitor | Potassium channel subfamily K member 2 | |
6 | Q01668_DB04855 | Q01668 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1D | |
7 | P51787_DB04855 | P51787 | inhibitor | Potassium voltage-gated channel subfamily KQT member 1 | |
8 | Q13698_DB04855 | Q13698 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1S | |
9 | P08588_DB04855 | P08588 | antagonist | Beta-1 adrenergic receptor | |
10 | Q14524_DB04855 | Q14524 | inhibitor | Sodium channel protein type 5 subunit alpha | |
11 | O00305_DB04855 | O00305 | inhibitor | Voltage-dependent L-type calcium channel subunit beta-4 | |
12 | Q13936_DB04855 | Q13936 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1C | |
13 | Q9UK17_DB04855 | Q9UK17 | inhibitor | Potassium voltage-gated channel subfamily D member 3 | |
14 | P10827_DB04855 | P10827 | inhibitor | Thyroid hormone receptor alpha | |
15 | P08913_DB04855 | P08913 | antagonist | Alpha-2A adrenergic receptor | |
16 | Q12809_DB04855 | Q12809 | inhibitor | Potassium voltage-gated channel subfamily H member 2 | IC50(nM) = 316.23 |
17 | P35368_DB04855 | P35368 | antagonist | Alpha-1B adrenergic receptor | |
18 | P35348_DB04855 | P35348 | antagonist | Alpha-1A adrenergic receptor | |
19 | Q08289_DB04855 | Q08289 | inhibitor | Voltage-dependent L-type calcium channel subunit beta-2 | |
20 | O60840_DB04855 | O60840 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1F | |
21 | P25100_DB04855 | P25100 | antagonist | Alpha-1D adrenergic receptor | |
22 | P48549_DB04855 | P48549 | inhibitor | G protein-activated inward rectifier potassium channel 1 | |
23 | P32418_DB04855 | P32418 | inhibitor | Sodium/calcium exchanger 1 |