DB04946 Iloperidone

InChI Key: XMXHEBAFVSFQEX-UHFFFAOYSA-N
SMILES: COC1=C(OCCCN2CCC(CC2)C2=NOC3=C2C=CC(F)=C3)C=CC(=C1)C(C)=O
Small molecule PDB accession : n/a

List of proteins that are targets for DB04946
# DrugDomain Data UniProt Accession Drug action Protein name Affinity data
1 P34969_DB04946 P34969 antagonist 5-hydroxytryptamine receptor 7 Ki(nM) = 112.0
2 P50406_DB04946 P50406 antagonist 5-hydroxytryptamine receptor 6 Ki(nM) = 63.1
3 P08908_DB04946 P08908 antagonist 5-hydroxytryptamine receptor 1A Ki(nM) = 33.0
4 P21728_DB04946 P21728 antagonist D Ki(nM) = 216.0
5 P18825_DB04946 P18825 antagonist Alpha-2C adrenergic receptor Ki(nM) = 16.2
6 P28223_DB04946 P28223 antagonist 5-hydroxytryptamine receptor 2A Ki(nM) = 0.12
7 P21917_DB04946 P21917 antagonist D Ki(nM) = 2.5
8 P14416_DB04946 P14416 antagonist D Ki(nM) = 0.35
IC50(nM) = 110.0
9 P35367_DB04946 P35367 antagonist Histamine H1 receptor Ki(nM) = 12.3
10 P35462_DB04946 P35462 antagonist D Ki(nM) = 7.1
11 P35348_DB04946 P35348 antagonist Alpha-1A adrenergic receptor Ki(nM) = 0.31