DB04946 Iloperidone
InChI Key: XMXHEBAFVSFQEX-UHFFFAOYSA-N
SMILES: COC1=C(OCCCN2CCC(CC2)C2=NOC3=C2C=CC(F)=C3)C=CC(=C1)C(C)=O
Small molecule PDB accession : n/a
List of proteins that are targets for DB04946
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P34969_DB04946 | P34969 | antagonist | 5-hydroxytryptamine receptor 7 | Ki(nM) = 112.0 |
2 | P50406_DB04946 | P50406 | antagonist | 5-hydroxytryptamine receptor 6 | Ki(nM) = 63.1 |
3 | P08908_DB04946 | P08908 | antagonist | 5-hydroxytryptamine receptor 1A | Ki(nM) = 33.0 |
4 | P21728_DB04946 | P21728 | antagonist | D | Ki(nM) = 216.0 |
5 | P18825_DB04946 | P18825 | antagonist | Alpha-2C adrenergic receptor | Ki(nM) = 16.2 |
6 | P28223_DB04946 | P28223 | antagonist | 5-hydroxytryptamine receptor 2A | Ki(nM) = 0.12 |
7 | P21917_DB04946 | P21917 | antagonist | D | Ki(nM) = 2.5 |
8 | P14416_DB04946 | P14416 | antagonist | D | Ki(nM) = 0.35 IC50(nM) = 110.0 |
9 | P35367_DB04946 | P35367 | antagonist | Histamine H1 receptor | Ki(nM) = 12.3 |
10 | P35462_DB04946 | P35462 | antagonist | D | Ki(nM) = 7.1 |
11 | P35348_DB04946 | P35348 | antagonist | Alpha-1A adrenergic receptor | Ki(nM) = 0.31 |