DB05785 LGD-1550
InChI Key: JMPZTWDLOGTBPM-OUQSKUGOSA-N
SMILES: C\C(\C=C\C=C(/C)C1=CC(=CC(=C1)C(C)(C)C)C(C)(C)C)=C/C(O)=O
Small molecule PDB accession : ARL
List of proteins that are targets for DB05785
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P10826_DB05785 | P10826 | n/a | Retinoic acid receptor beta | |
| 2 | P13631_DB05785 | P13631 | n/a | Retinoic acid receptor gamma | |
| 3 | P10276_DB05785 | P10276 | n/a | Retinoic acid receptor alpha | |
| 4 | P05412_DB05785 | P05412 | n/a | Transcription factor AP-1 |