DB06144 Sertindole
InChI Key: GZKLJWGUPQBVJQ-UHFFFAOYSA-N
SMILES: FC1=CC=C(C=C1)N1C=C(C2CCN(CCN3CCNC3=O)CC2)C2=C1C=CC(Cl)=C2
Small molecule PDB accession : n/a
List of proteins that are targets for DB06144
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P50406_DB06144 | P50406 | antagonist | 5-hydroxytryptamine receptor 6 | Ki(nM) = 5.0 |
| 2 | P28335_DB06144 | P28335 | antagonist | 5-hydroxytryptamine receptor 2C | Ki(nM) = 0.2 |
| 3 | P28223_DB06144 | P28223 | antagonist | 5-hydroxytryptamine receptor 2A | Ki(nM) = 0.14 |
| 4 | P14416_DB06144 | P14416 | antagonist | D | Ki(nM) = 0.45 |
| 5 | Q12809_DB06144 | Q12809 | inhibitor | Potassium voltage-gated channel subfamily H member 2 | Ki(nM) = 3.0 IC50(nM) = 2.7 |
| 6 | P35368_DB06144 | P35368 | n/a | Alpha-1B adrenergic receptor | |
| 7 | P35348_DB06144 | P35348 | n/a | Alpha-1A adrenergic receptor | Ki(nM) = 1.8 |
| 8 | P25100_DB06144 | P25100 | n/a | Alpha-1D adrenergic receptor |