DB06148 Mianserin
InChI Key: UEQUQVLFIPOEMF-UHFFFAOYSA-N
SMILES: CN1CCN2C(C1)C1=CC=CC=C1CC1=CC=CC=C21
Small molecule PDB accession : n/a
List of proteins that are targets for DB06148
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P34969_DB06148 | P34969 | antagonist | 5-hydroxytryptamine receptor 7 | |
| 2 | P50406_DB06148 | P50406 | binder | 5-hydroxytryptamine receptor 6 | |
| 3 | P30939_DB06148 | P30939 | binder | 5-hydroxytryptamine receptor 1F | |
| 4 | P08908_DB06148 | P08908 | blocker | 5-hydroxytryptamine receptor 1A | |
| 5 | P18825_DB06148 | P18825 | antagonist | Alpha-2C adrenergic receptor | |
| 6 | P18089_DB06148 | P18089 | antagonist | Alpha-2B adrenergic receptor | |
| 7 | P28335_DB06148 | P28335 | antagonist | 5-hydroxytryptamine receptor 2C | |
| 8 | P28223_DB06148 | P28223 | antagonist | 5-hydroxytryptamine receptor 2A | |
| 9 | P31645_DB06148 | P31645 | inhibitor | Sodium-dependent serotonin transporter | |
| 10 | P14416_DB06148 | P14416 | antagonist | D | |
| 11 | P41595_DB06148 | P41595 | binder | 5-hydroxytryptamine receptor 2B | |
| 12 | P41145_DB06148 | P41145 | agonist | Kappa-type opioid receptor | |
| 13 | P35367_DB06148 | P35367 | antagonist | Histamine H1 receptor | |
| 14 | P35462_DB06148 | P35462 | binder | D | |
| 15 | P08913_DB06148 | P08913 | antagonist | Alpha-2A adrenergic receptor | |
| 16 | P23975_DB06148 | P23975 | inhibitor | Sodium-dependent noradrenaline transporter | |
| 17 | Q01959_DB06148 | Q01959 | binder | Sodium-dependent dopamine transporter | |
| 18 | Q9H3N8_DB06148 | Q9H3N8 | binder | Histamine H4 receptor |