DB06216 Asenapine
InChI Key: VSWBSWWIRNCQIJ-UHFFFAOYSA-N
SMILES: CN1CC2C(C1)C1=C(OC3=CC=C(Cl)C=C23)C=CC=C1
Small molecule PDB accession : n/a
List of proteins that are targets for DB06216
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P34969_DB06216 | P34969 | antagonist | 5-hydroxytryptamine receptor 7 | |
2 | P50406_DB06216 | P50406 | antagonist | 5-hydroxytryptamine receptor 6 | |
3 | P47898_DB06216 | P47898 | antagonist | 5-hydroxytryptamine receptor 5A | |
4 | P25021_DB06216 | P25021 | antagonist | Histamine H2 receptor | |
5 | P08908_DB06216 | P08908 | antagonist | 5-hydroxytryptamine receptor 1A | Ki(nM) = 10.0 |
6 | P21728_DB06216 | P21728 | antagonist | D | |
7 | P18825_DB06216 | P18825 | antagonist | Alpha-2C adrenergic receptor | Ki(nM) = 13.0 |
8 | P18089_DB06216 | P18089 | antagonist | Alpha-2B adrenergic receptor | Ki(nM) = 0.49 |
9 | P28335_DB06216 | P28335 | antagonist | 5-hydroxytryptamine receptor 2C | Ki(nM) = 0.2 |
10 | P28223_DB06216 | P28223 | antagonist | 5-hydroxytryptamine receptor 2A | Ki(nM) = 0.26 |
11 | P21917_DB06216 | P21917 | antagonist | D | Ki(nM) = 3.8 |
12 | P14416_DB06216 | P14416 | antagonist | D | Ki(nM) = 1.87 |
13 | P41595_DB06216 | P41595 | antagonist | 5-hydroxytryptamine receptor 2B | |
14 | P28222_DB06216 | P28222 | antagonist | 5-hydroxytryptamine receptor 1B | Ki(nM) = 3.9 |
15 | P35367_DB06216 | P35367 | antagonist | Histamine H1 receptor | Ki(nM) = 0.16 |
16 | P35462_DB06216 | P35462 | antagonist | D | Ki(nM) = 1.8 |
17 | P08588_DB06216 | P08588 | antagonist | Beta-1 adrenergic receptor | Ki(nM) = 5000.0 |
18 | P08913_DB06216 | P08913 | antagonist | Alpha-2A adrenergic receptor | Ki(nM) = 6.5 |
19 | P07550_DB06216 | P07550 | antagonist | Beta-2 adrenergic receptor | Ki(nM) = 5000.0 |
20 | P35348_DB06216 | P35348 | antagonist | Alpha-1A adrenergic receptor | Ki(nM) = 1.1 |