DB06521 Ertiprotafib
InChI Key: FONCZICQWCUXEB-RUZDIDTESA-N
SMILES: CC1=C(C)C2=C(C3=CC(C)=C(O[C@H](CC4=CC=CC=C4)C(O)=O)C(C)=C3)C3=CC=CC=C3C(Br)=C2S1
Small molecule PDB accession : n/a
List of proteins that are targets for DB06521
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | O14920_DB06521 | O14920 | n/a | Inhibitor of nuclear factor kappa-B kinase subunit beta | |
| 2 | Q07869_DB06521 | Q07869 | n/a | Peroxisome proliferator-activated receptor alpha | |
| 3 | P37231_DB06521 | P37231 | n/a | Peroxisome proliferator-activated receptor gamma | |
| 4 | P18031_DB06521 | P18031 | n/a | Tyrosine-protein phosphatase non-receptor type 1 |