DB06589 Pazopanib
InChI Key: CUIHSIWYWATEQL-UHFFFAOYSA-N
SMILES: CN(C1=CC2=NN(C)C(C)=C2C=C1)C1=CC=NC(NC2=CC=C(C)C(=C2)S(N)(=O)=O)=N1
Small molecule PDB accession : n/a
List of proteins that are targets for DB06589
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P35916_DB06589 | P35916 | n/a | Vascular endothelial growth factor receptor 3 | IC50(nM) = 46.0 Kd(nM) = 27.0 |
2 | P35968_DB06589 | P35968 | inhibitor | Vascular endothelial growth factor receptor 2 | IC50(nM) = 30.0 Kd(nM) = 14.0 |
3 | Q08881_DB06589 | Q08881 | inhibitor | Tyrosine-protein kinase ITK/TSK | Kd(nM) = 10000.0 |
4 | P22607_DB06589 | P22607 | inhibitor | Fibroblast growth factor receptor 3 | Kd(nM) = 620.0 |
5 | P10721_DB06589 | P10721 | inhibitor | Mast/stem cell growth factor receptor Kit | Ki(nM) = 2300.0 IC50(nM) = 118.0 Kd(nM) = 1.8 |
6 | P16234_DB06589 | P16234 | inhibitor | Platelet-derived growth factor receptor alpha | IC50(nM) = 71.0 Kd(nM) = 4.9 |
7 | P09619_DB06589 | P09619 | inhibitor | Platelet-derived growth factor receptor beta | IC50(nM) = 83.0 Kd(nM) = 2.0 |
8 | P17948_DB06589 | P17948 | inhibitor | Vascular endothelial growth factor receptor 1 | IC50(nM) = 10.0 Kd(nM) = 14.0 |
9 | P05230_DB06589 | P05230 | inhibitor | Fibroblast growth factor 1 | |
10 | Q9UQQ2_DB06589 | Q9UQQ2 | inhibitor | SH2B adapter protein 3 |