DB06589 Pazopanib

InChI Key: CUIHSIWYWATEQL-UHFFFAOYSA-N
SMILES: CN(C1=CC2=NN(C)C(C)=C2C=C1)C1=CC=NC(NC2=CC=C(C)C(=C2)S(N)(=O)=O)=N1
Small molecule PDB accession : n/a

List of proteins that are targets for DB06589
# DrugDomain Data UniProt Accession Drug action Protein name Affinity data
1 P35916_DB06589 P35916 n/a Vascular endothelial growth factor receptor 3 IC50(nM) = 46.0
Kd(nM) = 27.0
2 P35968_DB06589 P35968 inhibitor Vascular endothelial growth factor receptor 2 IC50(nM) = 30.0
Kd(nM) = 14.0
3 Q08881_DB06589 Q08881 inhibitor Tyrosine-protein kinase ITK/TSK Kd(nM) = 10000.0
4 P22607_DB06589 P22607 inhibitor Fibroblast growth factor receptor 3 Kd(nM) = 620.0
5 P10721_DB06589 P10721 inhibitor Mast/stem cell growth factor receptor Kit Ki(nM) = 2300.0
IC50(nM) = 118.0
Kd(nM) = 1.8
6 P16234_DB06589 P16234 inhibitor Platelet-derived growth factor receptor alpha IC50(nM) = 71.0
Kd(nM) = 4.9
7 P09619_DB06589 P09619 inhibitor Platelet-derived growth factor receptor beta IC50(nM) = 83.0
Kd(nM) = 2.0
8 P17948_DB06589 P17948 inhibitor Vascular endothelial growth factor receptor 1 IC50(nM) = 10.0
Kd(nM) = 14.0
9 P05230_DB06589 P05230 inhibitor Fibroblast growth factor 1
10 Q9UQQ2_DB06589 Q9UQQ2 inhibitor SH2B adapter protein 3