DrugDomain - DB06594

DB06594 Agomelatine

InChI Key: YJYPHIXNFHFHND-UHFFFAOYSA-N
SMILES: COC1=CC2=C(CCNC(C)=O)C=CC=C2C=C1
Small molecule PDB accession : AWY

List of proteins that are targets for DB06594

# DrugDomain Data UniProt Accession Drug action Protein name Affinity data

1 P49286_DB06594 P49286 agonist Melatonin receptor type 1B Ki(nM) = 0.03
EC50(nM) = 0.1

2 P48039_DB06594 P48039 agonist Melatonin receptor type 1A Ki(nM) = 0.04
IC50(nM) = 0.0761
Kd(nM) = 0.1
EC50(nM) = 1.4

3 P28335_DB06594 P28335 antagonist 5-hydroxytryptamine receptor 2C Ki(nM) = 630.0

#	DrugDomain Data	UniProt Accession	Drug action	Protein name	Affinity data
1	P49286_DB06594	P49286	agonist	Melatonin receptor type 1B	Ki(nM) = 0.03 EC50(nM) = 0.1
2	P48039_DB06594	P48039	agonist	Melatonin receptor type 1A	Ki(nM) = 0.04 IC50(nM) = 0.0761 Kd(nM) = 0.1 EC50(nM) = 1.4
3	P28335_DB06594	P28335	antagonist	5-hydroxytryptamine receptor 2C	Ki(nM) = 630.0