DB06595 Midostaurin
InChI Key: BMGQWWVMWDBQGC-IIFHNQTCSA-N
SMILES: CO[C@@H]1[C@@H](C[C@H]2O[C@]1(C)N1C3=C(C=CC=C3)C3=C1C1=C(C4=C(C=CC=C4)N21)C1=C3CNC1=O)N(C)C(=O)C1=CC=CC=C1
Small molecule PDB accession : 2K2
List of proteins that are targets for DB06595
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P17252_DB06595 | P17252 | antagonist | Protein kinase C alpha type | |
| 2 | P35968_DB06595 | P35968 | antagonist | Vascular endothelial growth factor receptor 2 | |
| 3 | P36888_DB06595 | P36888 | antagonist | Receptor-type tyrosine-protein kinase FLT3 | |
| 4 | P10721_DB06595 | P10721 | antagonist | Mast/stem cell growth factor receptor Kit | |
| 5 | P16234_DB06595 | P16234 | antagonist | Platelet-derived growth factor receptor alpha | |
| 6 | P09619_DB06595 | P09619 | antagonist | Platelet-derived growth factor receptor beta |