DB06616 Bosutinib
InChI Key: UBPYILGKFZZVDX-UHFFFAOYSA-N
SMILES: COC1=CC(NC2=C(C=NC3=CC(OCCCN4CCN(C)CC4)=C(OC)C=C23)C#N)=C(Cl)C=C1Cl
Small molecule PDB accession : DB8
List of proteins that are targets for DB06616
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | Q13555_DB06616 | Q13555 | inhibitor | Calcium/calmodulin-dependent protein kinase type II subunit gamma | IC50(nM) = 184.0 Kd(nM) = 3600.0 |
| 2 | Q9Y2U5_DB06616 | Q9Y2U5 | inhibitor | Mitogen-activated protein kinase kinase kinase 2 | Kd(nM) = 30.0 |
| 3 | P07948_DB06616 | P07948 | n/a | Tyrosine-protein kinase Lyn | IC50(nM) = 8.0 Kd(nM) = 4.2 |
| 4 | Q02750_DB06616 | Q02750 | inhibitor | Dual specificity mitogen-activated protein kinase kinase 1 | IC50(nM) = 1.0 Kd(nM) = 19.0 |
| 5 | P36507_DB06616 | P36507 | inhibitor | Dual specificity mitogen-activated protein kinase kinase 2 | Kd(nM) = 9.9 |
| 6 | P11274_DB06616 | P11274 | inhibitor | Breakpoint cluster region protein | |
| 7 | P24941_DB06616 | P24941 | inhibitor | Cyclin-dependent kinase 2 | Kd(nM) = 10000.0 |
| 8 | P08631_DB06616 | P08631 | inhibitor | Tyrosine-protein kinase HCK | IC50(nM) = 3.2 Kd(nM) = 3.4 |
| 9 | P00519_DB06616 | P00519 | inhibitor | Tyrosine-protein kinase ABL1 | IC50(nM) = 0.5 Kd(nM) = 0.029 |
| 10 | P12931_DB06616 | P12931 | inhibitor | Proto-oncogene tyrosine-protein kinase Src | IC50(nM) = 1.0 Kd(nM) = 1.0 |