DB06663 Pasireotide
InChI Key: VMZMNAABQBOLAK-DBILLSOUSA-N
SMILES: NCCCC[C@@H]1NC(=O)[C@@H](CC2=CNC3=C2C=CC=C3)NC(=O)[C@@H](NC(=O)[C@@H]2C[C@H](CN2C(=O)[C@H](CC2=CC=CC=C2)NC(=O)[C@H](CC2=CC=C(OCC3=CC=CC=C3)C=C2)NC1=O)OC(=O)NCCN)C1=CC=CC=C1
Small molecule PDB accession : n/a
List of proteins that are targets for DB06663
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P30874_DB06663 | P30874 | n/a | Somatostatin receptor type 2 | |
| 2 | P30872_DB06663 | P30872 | n/a | Somatostatin receptor type 1 | |
| 3 | P32745_DB06663 | P32745 | n/a | Somatostatin receptor type 3 | |
| 4 | P35346_DB06663 | P35346 | n/a | Somatostatin receptor type 5 |