DB08059 Wortmannin
InChI Key: QDLHCMPXEPAAMD-QAIWCSMKSA-N
SMILES: [H][C@@]12CCC(=O)[C@@]1(C)C[C@@H](OC(C)=O)C1=C2C(=O)C2=C3C(=CO2)C(=O)O[C@H](COC)[C@]13C
Small molecule PDB accession : KWT
List of proteins that are targets for DB08059
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P42336_DB08059 | P42336 | n/a | Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit alpha isoform | Ki(nM) = 120.0 IC50(nM) = 1.0 Kd(nM) = 5.4 |
2 | P53350_DB08059 | P53350 | n/a | Serine/threonine-protein kinase PLK1 | Ki(nM) = 1500.0 IC50(nM) = 5.8 |
3 | P48736_DB08059 | P48736 | n/a | Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform | IC50(nM) = 5.0 Kd(nM) = 15.0 |
4 | P27986_DB08059 | P27986 | n/a | Phosphatidylinositol 3-kinase regulatory subunit alpha | IC50(nM) = 1.2 |