DB08059 Wortmannin

InChI Key: QDLHCMPXEPAAMD-QAIWCSMKSA-N
SMILES: [H][C@@]12CCC(=O)[C@@]1(C)C[C@@H](OC(C)=O)C1=C2C(=O)C2=C3C(=CO2)C(=O)O[C@H](COC)[C@]13C
Small molecule PDB accession : KWT

List of proteins that are targets for DB08059
# DrugDomain Data UniProt Accession Drug action Protein name Affinity data
1 P42336_DB08059 P42336 n/a Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit alpha isoform Ki(nM) = 120.0
IC50(nM) = 1.0
Kd(nM) = 5.4
2 P53350_DB08059 P53350 n/a Serine/threonine-protein kinase PLK1 Ki(nM) = 1500.0
IC50(nM) = 5.8
3 P48736_DB08059 P48736 n/a Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform IC50(nM) = 5.0
Kd(nM) = 15.0
4 P27986_DB08059 P27986 n/a Phosphatidylinositol 3-kinase regulatory subunit alpha IC50(nM) = 1.2