DB08453 2-Nonyl-4-quinolinol 1-oxide
InChI Key: LMBFBUICIQJLPK-UHFFFAOYSA-N
SMILES: CCCCCCCCCC1=[N+]([O-])C2=CC=CC=C2C(O)=C1
Small molecule PDB accession : QNO
List of proteins that are targets for DB08453
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | O14957_DB08453 | O14957 | n/a | Cytochrome b-c1 complex subunit 10 | |
| 2 | P00156_DB08453 | P00156 | n/a | Cytochrome b | |
| 3 | P08574_DB08453 | P08574 | n/a | Cytochrome c1, heme protein, mitochondrial | |
| 4 | P14927_DB08453 | P14927 | n/a | Cytochrome b-c1 complex subunit 7 | |
| 5 | P47985_DB08453 | P47985 | n/a | Cytochrome b-c1 complex subunit Rieske, mitochondrial | |
| 6 | Q9UDW1_DB08453 | Q9UDW1 | n/a | Cytochrome b-c1 complex subunit 9 | |
| 7 | O14949_DB08453 | O14949 | n/a | Cytochrome b-c1 complex subunit 8 | |
| 8 | P07919_DB08453 | P07919 | n/a | Cytochrome b-c1 complex subunit 6, mitochondrial | |
| 9 | P22695_DB08453 | P22695 | n/a | Cytochrome b-c1 complex subunit 2, mitochondrial | |
| 10 | P31930_DB08453 | P31930 | n/a | Cytochrome b-c1 complex subunit 1, mitochondrial |