DB08515 (3AR,6R,6AS)-6-((S)-((S)-CYCLOHEX-2-ENYL)(HYDROXY)METHYL)-6A-METHYL-4-OXO-HEXAHYDRO-2H-FURO[3,2-C]PYRROLE-6-CARBALDEHYDE
InChI Key: YVABESCRHMBHJD-FUQNVFFISA-N
SMILES: [H][C@](O)([C@@]1([H])CCCC=C1)[C@]1(NC(=O)[C@]2([H])CCO[C@]12C)C=O
Small molecule PDB accession : SA1
List of proteins that are targets for DB08515
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P28072_DB08515 | P28072 | n/a | Proteasome subunit beta type-6 | |
| 2 | Q99436_DB08515 | Q99436 | n/a | Proteasome subunit beta type-7 | |
| 3 | P60900_DB08515 | P60900 | n/a | Proteasome subunit alpha type-6 | |
| 4 | P49721_DB08515 | P49721 | n/a | Proteasome subunit beta type-2 | |
| 5 | O14818_DB08515 | O14818 | n/a | Proteasome subunit alpha type-7 | |
| 6 | P25786_DB08515 | P25786 | n/a | Proteasome subunit alpha type-1 | |
| 7 | P25787_DB08515 | P25787 | n/a | Proteasome subunit alpha type-2 | |
| 8 | P25789_DB08515 | P25789 | n/a | Proteasome subunit alpha type-4 | |
| 9 | P28066_DB08515 | P28066 | n/a | Proteasome subunit alpha type-5 | |
| 10 | P28070_DB08515 | P28070 | n/a | Proteasome subunit beta type-4 | |
| 11 | P49720_DB08515 | P49720 | n/a | Proteasome subunit beta type-3 | |
| 12 | P28074_DB08515 | P28074 | n/a | Proteasome subunit beta type-5 | |
| 13 | P20618_DB08515 | P20618 | n/a | Proteasome subunit beta type-1 | |
| 14 | P25788_DB08515 | P25788 | n/a | Proteasome subunit alpha type-3 |