DB08756 Y-27632
InChI Key: IYOZTVGMEWJPKR-IJLUTSLNSA-N
SMILES: [H][C@@]1(CC[C@@H](CC1)C(=O)NC1=CC=NC=C1)[C@@H](C)N
Small molecule PDB accession : Y27
List of proteins that are targets for DB08756
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | O75116_DB08756 | O75116 | n/a | Rho-associated protein kinase 2 | Ki(nM) = 60.0 IC50(nM) = 8.3 |
2 | P17612_DB08756 | P17612 | n/a | cAMP-dependent protein kinase catalytic subunit alpha | |
3 | Q13464_DB08756 | Q13464 | n/a | Rho-associated protein kinase 1 | Ki(nM) = 25.12 IC50(nM) = 46.0 |
4 | P61925_DB08756 | P61925 | n/a | cAMP-dependent protein kinase inhibitor alpha |