DB08815 Lurasidone
InChI Key: PQXKDMSYBGKCJA-CVTJIBDQSA-N
SMILES: [H][C@@]12[C@H]3CC[C@H](C3)[C@]1([H])C(=O)N(C[C@@H]1CCCC[C@H]1CN1CCN(CC1)C1=NSC3=CC=CC=C13)C2=O
Small molecule PDB accession : n/a
List of proteins that are targets for DB08815
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P34969_DB08815 | P34969 | antagonist | 5-hydroxytryptamine receptor 7 | Ki(nM) = 0.5 IC50(nM) = 16.0 |
| 2 | P08908_DB08815 | P08908 | antagonist | 5-hydroxytryptamine receptor 1A | Ki(nM) = 6.7 |
| 3 | P18825_DB08815 | P18825 | antagonist | Alpha-2C adrenergic receptor | |
| 4 | P28223_DB08815 | P28223 | antagonist | 5-hydroxytryptamine receptor 2A | Ki(nM) = 2.0 |
| 5 | P14416_DB08815 | P14416 | antagonist | D | Ki(nM) = 1.2 |
| 6 | P08913_DB08815 | P08913 | n/a | Alpha-2A adrenergic receptor |