DB08906 Fluticasone furoate
InChI Key: XTULMSXFIHGYFS-VLSRWLAYSA-N
SMILES: [H][C@@]12C[C@@H](C)[C@](OC(=O)C3=CC=CO3)(C(=O)SCF)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])C[C@H](F)C2=CC(=O)C=C[C@]12C
Small molecule PDB accession : GW6
List of proteins that are targets for DB08906
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P08235_DB08906 | P08235 | antagonist | Mineralocorticoid receptor | IC50(nM) = 166.0 EC50(nM) = 3000.0 |
| 2 | P04150_DB08906 | P04150 | agonist | Glucocorticoid receptor | Ki(nM) = 0.51 IC50(nM) = 0.0398 EC50(nM) = 0.4 |
| 3 | P06401_DB08906 | P06401 | agonist | Progesterone receptor | IC50(nM) = 21.0 |