DB09061 Cannabidiol
InChI Key: QHMBSVQNZZTUGM-ZWKOTPCHSA-N
SMILES: CCCCCC1=CC(O)=C([C@@H]2C=C(C)CC[C@H]2C(C)=C)C(O)=C1
Small molecule PDB accession : P0T
List of proteins that are targets for DB09061
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P35372_DB09061 | P35372 | n/a | Mu-type opioid receptor | |
2 | P47775_DB09061 | P47775 | inverse agonist | G-protein coupled receptor 12 | |
3 | Q9P0X4_DB09061 | Q9P0X4 | n/a | Voltage-dependent T-type calcium channel subunit alpha-1I | |
4 | P24462_DB09061 | P24462 | inhibitor | Cytochrome P450 3A7 | |
5 | P08908_DB09061 | P08908 | agonist | 5-hydroxytryptamine receptor 1A | |
6 | P23219_DB09061 | P23219 | inhibitor | Prostaglandin G/H synthase 1 | |
7 | Q8NER1_DB09061 | Q8NER1 | activator | Transient receptor potential cation channel subfamily V member 1 | |
8 | O43497_DB09061 | O43497 | n/a | Voltage-dependent T-type calcium channel subunit alpha-1G | |
9 | Q8NET8_DB09061 | Q8NET8 | activator | Transient receptor potential cation channel subfamily V member 3 | |
10 | Q02083_DB09061 | Q02083 | inhibitor | N-acylethanolamine-hydrolyzing acid amidase | |
11 | P28223_DB09061 | P28223 | agonist | 5-hydroxytryptamine receptor 2A | |
12 | P20815_DB09061 | P20815 | inhibitor | Cytochrome P450 3A5 | |
13 | P30542_DB09061 | P30542 | activator | Adenosine receptor A1 | |
14 | P35354_DB09061 | P35354 | inhibitor | Prostaglandin G/H synthase 2 | |
15 | O75311_DB09061 | O75311 | potentiator | Glycine receptor subunit alpha-3 | |
16 | P41143_DB09061 | P41143 | n/a | Delta-type opioid receptor | |
17 | Q9HBA0_DB09061 | Q9HBA0 | activator | Transient receptor potential cation channel subfamily V member 4 | |
18 | P05093_DB09061 | P05093 | inhibitor | Steroid 17-alpha-hydroxylase/17,20 lyase | |
19 | Q16678_DB09061 | Q16678 | inhibitor | Cytochrome P450 1B1 | |
20 | O75762_DB09061 | O75762 | agonist | Transient receptor potential cation channel subfamily A member 1 | |
21 | P36544_DB09061 | P36544 | n/a | Neuronal acetylcholine receptor subunit alpha-7 | |
22 | P34972_DB09061 | P34972 | antagonist | Cannabinoid receptor 2 | |
23 | P21796_DB09061 | P21796 | n/a | Voltage-dependent anion-selective channel protein 1 | |
24 | P05177_DB09061 | P05177 | inhibitor | Cytochrome P450 1A2 | |
25 | P10635_DB09061 | P10635 | inhibitor | Cytochrome P450 2D6 | |
26 | P07203_DB09061 | P07203 | stimulator | Glutathione peroxidase 1 | |
27 | Q9Y5S1_DB09061 | Q9Y5S1 | activator | Transient receptor potential cation channel subfamily V member 2 | |
28 | P24752_DB09061 | P24752 | inhibitor | Acetyl-CoA acetyltransferase, mitochondrial | |
29 | P14902_DB09061 | P14902 | inhibitor | Indoleamine 2,3-dioxygenase 1 | |
30 | P23415_DB09061 | P23415 | n/a | Glycine receptor subunit alpha-1 | |
31 | P21554_DB09061 | P21554 | antagonist | Cannabinoid receptor 1 | |
32 | P37231_DB09061 | P37231 | activator | Peroxisome proliferator-activated receptor gamma | |
33 | P04035_DB09061 | P04035 | stimulator | 3-hydroxy-3-methylglutaryl-coenzyme A reductase | |
34 | P04040_DB09061 | P04040 | inhibitor | Catalase | |
35 | P15559_DB09061 | P15559 | inhibitor | NAD | |
36 | P00441_DB09061 | P00441 | inhibitor | Superoxide dismutase [Cu-Zn] | |
37 | P00390_DB09061 | P00390 | stimulator | Glutathione reductase, mitochondrial | |
38 | Q7Z2W7_DB09061 | Q7Z2W7 | n/a | Transient receptor potential cation channel subfamily M member 8 | |
39 | O95180_DB09061 | O95180 | n/a | Voltage-dependent T-type calcium channel subunit alpha-1H | |
40 | Q9Y2T6_DB09061 | Q9Y2T6 | antagonist | G-protein coupled receptor 55 | |
41 | Q14330_DB09061 | Q14330 | n/a | N-arachidonyl glycine receptor | |
42 | P46098_DB09061 | P46098 | antagonist | 5-hydroxytryptamine receptor 3A |