DB09099 Somatostatin
InChI Key: NHXLMOGPVYXJNR-ATOGVRKGSA-N
SMILES: C[C@@H](O)[C@@H]1NC(=O)[C@H](CC2=CC=CC=C2)NC(=O)[C@@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC2=CNC3=C2C=CC=C3)NC(=O)[C@H](CC2=CC=CC=C2)NC(=O)[C@H](CC2=CC=CC=C2)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CSSC[C@H](NC(=O)[C@H](CO)NC1=O)C(O)=O)NC(=O)CNC(=O)[C@H](C)N)[C@@H](C)O
Small molecule PDB accession : n/a
List of proteins that are targets for DB09099
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P31391_DB09099 | P31391 | agonist | Somatostatin receptor type 4 | |
| 2 | P30874_DB09099 | P30874 | agonist | Somatostatin receptor type 2 | |
| 3 | P30872_DB09099 | P30872 | agonist | Somatostatin receptor type 1 | |
| 4 | P32745_DB09099 | P32745 | agonist | Somatostatin receptor type 3 | |
| 5 | P35346_DB09099 | P35346 | agonist | Somatostatin receptor type 5 |