DB09213 Dexibuprofen
InChI Key: HEFNNWSXXWATRW-JTQLQIEISA-N
SMILES: CC(C)CC1=CC=C(C=C1)[C@H](C)C(O)=O
Small molecule PDB accession : IBP
List of proteins that are targets for DB09213
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P46059_DB09213 | P46059 | n/a | Solute carrier family 15 member 1 | |
2 | P23219_DB09213 | P23219 | inhibitor | Prostaglandin G/H synthase 1 | IC50(nM) = 99.0 |
3 | P35354_DB09213 | P35354 | inhibitor | Prostaglandin G/H synthase 2 | IC50(nM) = 730.0 |
4 | P13569_DB09213 | P13569 | inhibitor | Cystic fibrosis transmembrane conductance regulator | |
5 | P31151_DB09213 | P31151 | n/a | Protein S100-A7 | |
6 | P12104_DB09213 | P12104 | binder | Fatty acid-binding protein, intestinal | |
7 | Q07869_DB09213 | Q07869 | n/a | Peroxisome proliferator-activated receptor alpha | |
8 | P07359_DB09213 | P07359 | n/a | Platelet glycoprotein Ib alpha chain | |
9 | P10415_DB09213 | P10415 | negative modulator | Apoptosis regulator Bcl-2 | |
10 | P37231_DB09213 | P37231 | activator | Peroxisome proliferator-activated receptor gamma | |
11 | P07204_DB09213 | P07204 | modulator | Thrombomodulin | |
12 | P00750_DB09213 | P00750 | modulator | Tissue-type plasminogen activator |