DB11619 Gestrinone
InChI Key: BJJXHLWLUDYTGC-ANULTFPQSA-N
SMILES: [H][C@@]12CC[C@@](O)(C#C)[C@@]1(CC)C=CC1=C3CCC(=O)C=C3CC[C@@]21[H]
Small molecule PDB accession : n/a
List of proteins that are targets for DB11619
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P30968_DB11619 | P30968 | antagonist | Gonadotropin-releasing hormone receptor | |
| 2 | P04150_DB11619 | P04150 | antagonist | Glucocorticoid receptor | |
| 3 | P10275_DB11619 | P10275 | antagonist | Androgen receptor | |
| 4 | P04278_DB11619 | P04278 | antagonist | Sex hormone-binding globulin | |
| 5 | P03372_DB11619 | P03372 | antagonist | Estrogen receptor | |
| 6 | P06401_DB11619 | P06401 | antagonist | Progesterone receptor |