DB11633 Isavuconazole
InChI Key: DDFOUSQFMYRUQK-RCDICMHDSA-N
SMILES: C[C@@H](C1=NC(=CS1)C1=CC=C(C=C1)C#N)[C@](O)(CN1C=NC=N1)C1=C(F)C=CC(F)=C1
Small molecule PDB accession : QKM
List of proteins that are targets for DB11633
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | Q92806_DB11633 | Q92806 | inhibitor | G protein-activated inward rectifier potassium channel 3 | |
| 2 | Q14654_DB11633 | Q14654 | inhibitor | ATP-sensitive inward rectifier potassium channel 11 | |
| 3 | P51787_DB11633 | P51787 | inhibitor | Potassium voltage-gated channel subfamily KQT member 1 | |
| 4 | Q14524_DB11633 | Q14524 | inhibitor | Sodium channel protein type 5 subunit alpha | |
| 5 | Q13936_DB11633 | Q13936 | inhibitor | Voltage-dependent L-type calcium channel subunit alpha-1C | |
| 6 | Q9UK17_DB11633 | Q9UK17 | inhibitor | Potassium voltage-gated channel subfamily D member 3 | |
| 7 | Q12809_DB11633 | Q12809 | inhibitor | Potassium voltage-gated channel subfamily H member 2 | |
| 8 | P22460_DB11633 | P22460 | inhibitor | Potassium voltage-gated channel subfamily A member 5 | |
| 9 | P48051_DB11633 | P48051 | inhibitor | G protein-activated inward rectifier potassium channel 2 |