DB11755 Tetrahydrocannabivarin
InChI Key: ZROLHBHDLIHEMS-HUUCEWRRSA-N
SMILES: CCCC1=CC(O)=C2[C@@H]3C=C(C)CC[C@H]3C(C)(C)OC2=C1
Small molecule PDB accession : n/a
List of proteins that are targets for DB11755
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P08908_DB11755 | P08908 | agonist | 5-hydroxytryptamine receptor 1A | |
| 2 | O75762_DB11755 | O75762 | agonist | Transient receptor potential cation channel subfamily A member 1 | |
| 3 | P34972_DB11755 | P34972 | partial agonist | Cannabinoid receptor 2 | |
| 4 | Q9Y5S1_DB11755 | Q9Y5S1 | agonist | Transient receptor potential cation channel subfamily V member 2 | |
| 5 | P21554_DB11755 | P21554 | antagonist | Cannabinoid receptor 1 | |
| 6 | Q7Z2W7_DB11755 | Q7Z2W7 | antagonist | Transient receptor potential cation channel subfamily M member 8 | |
| 7 | Q9Y2T6_DB11755 | Q9Y2T6 | partial agonist | G-protein coupled receptor 55 |