DB11800 Tivozanib
InChI Key: SPMVMDHWKHCIDT-UHFFFAOYSA-N
SMILES: COC1=C(OC)C=C2C(OC3=CC(Cl)=C(NC(=O)NC4=NOC(C)=C4)C=C3)=CC=NC2=C1
Small molecule PDB accession : AV9
List of proteins that are targets for DB11800
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P35916_DB11800 | P35916 | inhibitor | Vascular endothelial growth factor receptor 3 | |
2 | P35968_DB11800 | P35968 | inhibitor | Vascular endothelial growth factor receptor 2 | |
3 | P36888_DB11800 | P36888 | inhibitor | Receptor-type tyrosine-protein kinase FLT3 | |
4 | Q13882_DB11800 | Q13882 | n/a | Protein-tyrosine kinase 6 | |
5 | P10721_DB11800 | P10721 | inhibitor | Mast/stem cell growth factor receptor Kit | |
6 | P16234_DB11800 | P16234 | inhibitor | Platelet-derived growth factor receptor alpha | |
7 | P09619_DB11800 | P09619 | inhibitor | Platelet-derived growth factor receptor beta | |
8 | P08581_DB11800 | P08581 | inhibitor | Hepatocyte growth factor receptor | |
9 | Q02763_DB11800 | Q02763 | n/a | Angiopoietin-1 receptor | |
10 | P17948_DB11800 | P17948 | inhibitor | Vascular endothelial growth factor receptor 1 | |
11 | P11362_DB11800 | P11362 | inhibitor | Fibroblast growth factor receptor 1 |