DB12843 Oleandrin
InChI Key: JLPDBLFIVFSOCC-XYXFTTADSA-N
SMILES: CO[C@H]1C[C@H](O[C@H]2CC[C@@]3(C)[C@H](CC[C@@H]4[C@@H]3CC[C@]3(C)[C@H]([C@H](C[C@]43O)OC(C)=O)C3=CC(=O)OC3)C2)O[C@@H](C)[C@@H]1O
Small molecule PDB accession : n/a
List of proteins that are targets for DB12843
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P01138_DB12843 | P01138 | inhibitor | Beta-nerve growth factor | |
| 2 | P01133_DB12843 | P01133 | inhibitor | Pro-epidermal growth factor | |
| 3 | P10145_DB12843 | P10145 | inhibitor | Interleukin-8 | |
| 4 | P14780_DB12843 | P14780 | inhibitor | Matrix metalloproteinase-9 | |
| 5 | P10415_DB12843 | P10415 | downregulator | Apoptosis regulator Bcl-2 | |
| 6 | Q14790_DB12843 | Q14790 | regulator | Caspase-8 | |
| 7 | P42574_DB12843 | P42574 | regulator | Caspase-3 | |
| 8 | P08253_DB12843 | P08253 | inhibitor | 72 kDa type IV collagenase | |
| 9 | P29323_DB12843 | P29323 | activator | Ephrin type-B receptor 2 | |
| 10 | P42345_DB12843 | P42345 | downregulator | Serine/threonine-protein kinase mTOR |