DB13985 Lutetium Lu 177 dotatate
InChI Key: MXDPZUIOZWKRAA-PRDSJKGBSA-K
SMILES: [177Lu+3].C[C@@H](O)[C@H](NC(=O)[C@@H]1CSSC[C@H](NC(=O)[C@@H](CC2=CC=CC=C2)NC(=O)CN2CCN(CC([O-])=O)CCN(CC([O-])=O)CCN(CC([O-])=O)CC2)C(=O)N[C@@H](CC2=CC=C(O)C=C2)C(=O)N[C@H](CC2=CNC3=C2C=CC=C3)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1)C(O)=O
Small molecule PDB accession : n/a
List of proteins that are targets for DB13985
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P31391_DB13985 | P31391 | agonist | Somatostatin receptor type 4 | |
| 2 | P30874_DB13985 | P30874 | agonist | Somatostatin receptor type 2 | |
| 3 | P30872_DB13985 | P30872 | agonist | Somatostatin receptor type 1 | |
| 4 | P32745_DB13985 | P32745 | agonist | Somatostatin receptor type 3 | |
| 5 | P35346_DB13985 | P35346 | agonist | Somatostatin receptor type 5 |