DB14011 Nabiximols
InChI Key: SSNHGLKFJISNTR-DYSNNVSPSA-N
SMILES: [H][C@]1(CCC(C)=C[C@@]1([H])C1=C(O)C=C(CCCCC)C=C1O)C(C)=C.[H][C@@]12CCC(C)=C[C@@]1([H])C1=C(O)C=C(CCCCC)C=C1OC2(C)C
Small molecule PDB accession : n/a
List of proteins that are targets for DB14011
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P35372_DB14011 | P35372 | n/a | Mu-type opioid receptor | |
2 | P47775_DB14011 | P47775 | inverse agonist | G-protein coupled receptor 12 | |
3 | Q9P0X4_DB14011 | Q9P0X4 | n/a | Voltage-dependent T-type calcium channel subunit alpha-1I | |
4 | P24462_DB14011 | P24462 | inhibitor | Cytochrome P450 3A7 | |
5 | P08908_DB14011 | P08908 | n/a | 5-hydroxytryptamine receptor 1A | |
6 | P23219_DB14011 | P23219 | inhibitor | Prostaglandin G/H synthase 1 | |
7 | Q8NER1_DB14011 | Q8NER1 | n/a | Transient receptor potential cation channel subfamily V member 1 | |
8 | O43497_DB14011 | O43497 | n/a | Voltage-dependent T-type calcium channel subunit alpha-1G | |
9 | Q8NET8_DB14011 | Q8NET8 | n/a | Transient receptor potential cation channel subfamily V member 3 | |
10 | Q02083_DB14011 | Q02083 | inhibitor | N-acylethanolamine-hydrolyzing acid amidase | |
11 | P28223_DB14011 | P28223 | n/a | 5-hydroxytryptamine receptor 2A | |
12 | P20815_DB14011 | P20815 | inhibitor | Cytochrome P450 3A5 | |
13 | P35354_DB14011 | P35354 | inhibitor | Prostaglandin G/H synthase 2 | |
14 | O75311_DB14011 | O75311 | n/a | Glycine receptor subunit alpha-3 | |
15 | P41143_DB14011 | P41143 | n/a | Delta-type opioid receptor | |
16 | P04798_DB14011 | P04798 | inhibitor | Cytochrome P450 1A1 | |
17 | Q9HBA0_DB14011 | Q9HBA0 | n/a | Transient receptor potential cation channel subfamily V member 4 | |
18 | P05093_DB14011 | P05093 | inhibitor | Steroid 17-alpha-hydroxylase/17,20 lyase | |
19 | Q16678_DB14011 | Q16678 | inhibitor | Cytochrome P450 1B1 | |
20 | O75762_DB14011 | O75762 | n/a | Transient receptor potential cation channel subfamily A member 1 | |
21 | P36544_DB14011 | P36544 | n/a | Neuronal acetylcholine receptor subunit alpha-7 | |
22 | P34972_DB14011 | P34972 | n/a | Cannabinoid receptor 2 | |
23 | P21796_DB14011 | P21796 | n/a | Voltage-dependent anion-selective channel protein 1 | |
24 | P05177_DB14011 | P05177 | inhibitor | Cytochrome P450 1A2 | |
25 | P10635_DB14011 | P10635 | substrate | Cytochrome P450 2D6 | |
26 | P07203_DB14011 | P07203 | stimulator | Glutathione peroxidase 1 | |
27 | Q9Y5S1_DB14011 | Q9Y5S1 | n/a | Transient receptor potential cation channel subfamily V member 2 | |
28 | P24752_DB14011 | P24752 | inhibitor | Acetyl-CoA acetyltransferase, mitochondrial | |
29 | P14902_DB14011 | P14902 | inhibitor | Indoleamine 2,3-dioxygenase 1 | |
30 | Q08257_DB14011 | Q08257 | inhibitor | Quinone oxidoreductase | |
31 | P23415_DB14011 | P23415 | n/a | Glycine receptor subunit alpha-1 | |
32 | P21554_DB14011 | P21554 | n/a | Cannabinoid receptor 1 | |
33 | P37231_DB14011 | P37231 | n/a | Peroxisome proliferator-activated receptor gamma | |
34 | P04035_DB14011 | P04035 | stimulator | 3-hydroxy-3-methylglutaryl-coenzyme A reductase | |
35 | P04040_DB14011 | P04040 | inhibitor | Catalase | |
36 | P00441_DB14011 | P00441 | inhibitor | Superoxide dismutase [Cu-Zn] | |
37 | P00390_DB14011 | P00390 | stimulator | Glutathione reductase, mitochondrial | |
38 | Q7Z2W7_DB14011 | Q7Z2W7 | n/a | Transient receptor potential cation channel subfamily M member 8 | |
39 | O95180_DB14011 | O95180 | n/a | Voltage-dependent T-type calcium channel subunit alpha-1H | |
40 | Q9Y2T6_DB14011 | Q9Y2T6 | n/a | G-protein coupled receptor 55 | |
41 | Q14330_DB14011 | Q14330 | n/a | N-arachidonyl glycine receptor | |
42 | O00519_DB14011 | O00519 | inhibitor | Fatty-acid amide hydrolase 1 |