DB14050 Cannabidivarin
InChI Key: REOZWEGFPHTFEI-JKSUJKDBSA-N
SMILES: [H][C@]1(CCC(C)=C[C@H]1C1=C(O)C=C(CCC)C=C1O)C(C)=C
Small molecule PDB accession : n/a
List of proteins that are targets for DB14050
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | Q8NER1_DB14050 | Q8NER1 | agonist | Transient receptor potential cation channel subfamily V member 1 | |
2 | O75762_DB14050 | O75762 | agonist | Transient receptor potential cation channel subfamily A member 1 | |
3 | Q9Y5S1_DB14050 | Q9Y5S1 | agonist | Transient receptor potential cation channel subfamily V member 2 |