DB15494 Edotreotide gallium Ga-68
InChI Key: PZBPHYLKIMOZPR-FIYGWYQWSA-K
SMILES: [68Ga+3].C[C@@H](O)[C@@H](CO)NC(=O)[C@@H]1CSSC[C@H](NC(=O)[C@@H](CC2=CC=CC=C2)NC(=O)CN2CCN(CC([O-])=O)CCN(CC([O-])=O)CCN(CC([O-])=O)CC2)C(=O)N[C@@H](CC2=CC=C(O)C=C2)C(=O)N[C@H](CC2=CNC3=C2C=CC=C3)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1
Small molecule PDB accession : n/a
List of proteins that are targets for DB15494
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P30874_DB15494 | P30874 | ligand | Somatostatin receptor type 2 | |
| 2 | P30872_DB15494 | P30872 | ligand | Somatostatin receptor type 1 | |
| 3 | P32745_DB15494 | P32745 | ligand | Somatostatin receptor type 3 | |
| 4 | P35346_DB15494 | P35346 | ligand | Somatostatin receptor type 5 |