DB15822 Pralsetinib
InChI Key: GBLBJPZSROAGMF-RWYJCYHVSA-N
SMILES: CO[C@@]1(CC[C@@H](CC1)C1=NC(NC2=NNC(C)=C2)=CC(C)=N1)C(=O)N[C@@H](C)C1=CC=C(N=C1)N1C=C(F)C=N1
Small molecule PDB accession : Q4J
List of proteins that are targets for DB15822
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | Q08345_DB15822 | Q08345 | inhibitor | Epithelial discoidin domain-containing receptor 1 | |
2 | P23458_DB15822 | P23458 | inhibitor | Tyrosine-protein kinase JAK1 | |
3 | P07949_DB15822 | P07949 | inhibitor | Proto-oncogene tyrosine-protein kinase receptor Ret | |
4 | O60674_DB15822 | O60674 | inhibitor | Tyrosine-protein kinase JAK2 | |
5 | Q16288_DB15822 | Q16288 | inhibitor | NT-3 growth factor receptor | |
6 | P35968_DB15822 | P35968 | inhibitor | Vascular endothelial growth factor receptor 2 | |
7 | P36888_DB15822 | P36888 | inhibitor | Receptor-type tyrosine-protein kinase FLT3 | |
8 | P04629_DB15822 | P04629 | inhibitor | High affinity nerve growth factor receptor | |
9 | P09619_DB15822 | P09619 | inhibitor | Platelet-derived growth factor receptor beta | |
10 | P21802_DB15822 | P21802 | inhibitor | Fibroblast growth factor receptor 2 | |
11 | P11362_DB15822 | P11362 | inhibitor | Fibroblast growth factor receptor 1 |