O15554 KCNN4_HUMAN
Gene name: KCNN4
Protein name: Intermediate conductance calcium-activated potassium channel protein 4
List of molecules and drugs that target protein O15554
| # | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
|---|---|---|---|---|---|---|---|
| 1 | O15554_DB00257 | DB00257 | Clotrimazole | inhibitor | IC50(nM) = 70.0 | VNFPBHJOKIVQEB-UHFFFAOYSA-N | ClC1=CC=CC=C1C(N1C=CN=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| 2 | O15554_DB00468 | DB00468 | Quinine | inhibitor | LOUPRKONTZGTKE-WZBLMQSHSA-N | [H][C@]1(C[C@@H]2CC[N@]1C[C@@H]2C=C)[C@H](O)C1=CC=NC2=CC=C(OC)C=C12 | |
| 3 | O15554_DB01159 | DB01159 | Halothane | inhibitor | BCQZXOMGPXTTIC-UHFFFAOYSA-N | [H]C(Cl)(Br)C(F)(F)F |