O43613 OX1R_HUMAN
Gene name: HCRTR1
Protein name: Orexin receptor type 1
List of molecules and drugs that target protein O43613
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | O43613_DB09034 | DB09034 | Suvorexant | antagonist | Ki(nM) = 0.398107 IC50(nM) = 50.0 | JYTNQNCOQXFQPK-MRXNPFEDSA-N | [H][C@@]1(C)CCN(CCN1C(=O)C1=C(C=CC(C)=C1)N1N=CC=N1)C1=NC2=C(O1)C=CC(Cl)=C2 |
2 | O43613_DB11951 | DB11951 | Lemborexant | antagonist | MUGXRYIUWFITCP-PGRDOPGGSA-N | CC1=NC=C(OC[C@]2(C[C@H]2C(=O)NC2=NC=C(F)C=C2)C2=CC=CC(F)=C2)C(C)=N1 | |
3 | O43613_DB15031 | DB15031 | Daridorexant | antagonist | NBGABHGMJVIVBW-QHCPKHFHSA-N | COC1=CC(C(=O)N2CCC[C@@]2(C)C2=NC3=C(N2)C=CC(Cl)=C3C)=C(C=C1)N1N=CC=N1 |