P00480 OTC_HUMAN
Gene name: OTC
Protein name: Ornithine carbamoyltransferase, mitochondrial
List of molecules and drugs that target protein P00480
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | P00480_DB00129 | DB00129 | Ornithine | n/a | AHLPHDHHMVZTML-BYPYZUCNSA-N | NCCC[C@H](N)C(O)=O | |
2 | P00480_DB00155 | DB00155 | Citrulline | n/a | RHGKLRLOHDJJDR-BYPYZUCNSA-N | N[C@@H](CCCNC(N)=O)C(O)=O | |
3 | P00480_DB02011 | DB02011 | N-(Phosphonoacetyl)-L-Ornithine | n/a | FCIHAQFHXJOLIF-YFKPBYRVSA-N | N[C@@H](CCCNC(=O)CP(O)(O)=O)C(O)=O | |
4 | P00480_DB04185 | DB04185 | Norvaline | n/a | SNDPXSYFESPGGJ-BYPYZUCNSA-N | CCC[C@H](N)C(O)=O |