P00558 PGK1_HUMAN
Gene name: PGK1
Protein name: Phosphoglycerate kinase 1
List of molecules and drugs that target protein P00558
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | P00558_DB03909 | DB03909 | Adenosine-5'-[Beta, Gamma-Methylene]Triphosphate | n/a | UFZTZBNSLXELAL-IOSLPCCCSA-N | [H][C@]1(COP(O)(=O)OP(O)(=O)CP(O)(O)=O)O[C@@]([H])(N2C=NC3=C(N)N=CN=C23)[C@]([H])(O)[C@]1([H])O | |
2 | P00558_DB04510 | DB04510 | 3-phospho-D-glyceric acid | n/a | OSJPPGNTCRNQQC-UWTATZPHSA-N | O[C@H](COP(O)(O)=O)C(O)=O | |
3 | P00558_DB09130 | DB09130 | Copper | n/a | RYGMFSIKBFXOCR-UHFFFAOYSA-N | [Cu] | |
4 | P00558_DB11638 | DB11638 | Artenimol | ligand | BJDCWCLMFKKGEE-HVDUHBCDSA-N | [H][C@@]1(C)CC[C@@]2([H])[C@@]([H])(C)C([H])(O)O[C@]3([H])O[C@@]4(C)CC[C@]1([H])[C@@]23OO4 |