P00747 PLMN_HUMAN
Gene name: PLG
Protein name: Plasminogen
List of molecules and drugs that target protein P00747
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | P00747_DB00302 | DB00302 | Tranexamic acid | inhibitor | Ki(nM) = 2.5E7 IC50(nM) = 3100.0 Kd(nM) = 1100.0 | GYDJEQRTZSCIOI-LJGSYFOKSA-N | NC[C@H]1CC[C@@H](CC1)C(O)=O |
2 | P00747_DB00513 | DB00513 | Aminocaproic acid | inhibitor | Ki(nM) = 5.3E7 IC50(nM) = 40000.0 Kd(nM) = 9000.0 | SLXKOJJOQWFEFD-UHFFFAOYSA-N | NCCCCCC(O)=O |
3 | P00747_DB03709 | DB03709 | Bicine | n/a | FSVCELGFZIQNCK-UHFFFAOYSA-N | OCCN(CCO)CC(O)=O | |
4 | P00747_DB09130 | DB09130 | Copper | n/a | RYGMFSIKBFXOCR-UHFFFAOYSA-N | [Cu] | |
5 | P00747_DB12831 | DB12831 | Gabexate | inhibitor | YKGYIDJEEQRWQH-UHFFFAOYSA-N | CCOC(=O)C1=CC=C(OC(=O)CCCCCNC(N)=N)C=C1 |