P00966 ASSY_HUMAN
Gene name: ASS1
Protein name: Argininosuccinate synthase
List of molecules and drugs that target protein P00966
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | P00966_DB00125 | DB00125 | Arginine | n/a | ODKSFYDXXFIFQN-BYPYZUCNSA-N | N[C@@H](CCCNC(N)=N)C(O)=O | |
2 | P00966_DB00128 | DB00128 | Aspartic acid | n/a | CKLJMWTZIZZHCS-REOHCLBHSA-N | N[C@@H](CC(O)=O)C(O)=O | |
3 | P00966_DB00155 | DB00155 | Citrulline | n/a | RHGKLRLOHDJJDR-BYPYZUCNSA-N | N[C@@H](CCCNC(N)=O)C(O)=O | |
4 | P00966_DB00171 | DB00171 | ATP | n/a | ZKHQWZAMYRWXGA-KQYNXXCUSA-N | NC1=NC=NC2=C1N=CN2[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O |