P01106 MYC_HUMAN
Gene name: MYC
Protein name: Myc proto-oncogene protein
List of molecules and drugs that target protein P01106
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | P01106_DB00945 | DB00945 | Acetylsalicylic acid | downregulator | BSYNRYMUTXBXSQ-UHFFFAOYSA-N | CC(=O)OC1=CC=CC=C1C(O)=O | |
2 | P01106_DB01093 | DB01093 | Dimethyl sulfoxide | downregulator | IAZDPXIOMUYVGZ-UHFFFAOYSA-N | CS(C)=O | |
3 | P01106_DB03756 | DB03756 | Doconexent | inhibitor | MBMBGCFOFBJSGT-KUBAVDMBSA-N | CC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CCC(O)=O |